C19H20BrN5O4S2 — CID 142898984
4-[2-[[5-bromo-2-(4-methylsulfonylanilino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide (PubChem CID 142898984) has the molecular formula C19H20BrN5O4S2 and a molecular weight of 526.44 g/mol. Its IUPAC name is 4-[2-[[5-bromo-2-(4-methylsulfonylanilino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[[5-bromo-2-(4-methylsulfonylanilino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 142898984 |
| Molecular Formula | C19H20BrN5O4S2 |
| Molecular Weight | 526.44 g/mol |
| Exact Mass | 525.01 |
| IUPAC Name | 4-[2-[[5-bromo-2-(4-methylsulfonylanilino)pyrimidin-4-yl]amino]ethyl]benzenesulfonamide |
| SMILES | CS(=O)(=O)c1ccc(Nc2ncc(Br)c(NCCc3ccc(S(N)(=O)=O)cc3)n2)cc1 |
| InChI | InChI=1S/C19H20BrN5O4S2/c1-30(26,27)15-8-4-14(5-9-15)24-19-23-12-17(20)18(25-19)22-11-10-13-2-6-16(7-3-13)31(21,28)29/h2-9,12H,10-11H2,1H3,(H2,21,28,29)(H2,22,23,24,25) |
| InChIKey | PAPXEJZASIFADL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 144.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |