C17H15BrFN5O2S — CID 58890879
4-[[5-bromo-4-[(4-fluorophenyl)methylamino]pyrimidin-2-yl]amino]benzenesulfonamide (PubChem CID 58890879) has the molecular formula C17H15BrFN5O2S and a molecular weight of 452.31 g/mol. Its IUPAC name is 4-[[5-bromo-4-[(4-fluorophenyl)methylamino]pyrimidin-2-yl]amino]benzenesulfonamide.
| Compound Name | 4-[[5-bromo-4-[(4-fluorophenyl)methylamino]pyrimidin-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 58890879 |
| Molecular Formula | C17H15BrFN5O2S |
| Molecular Weight | 452.31 g/mol |
| Exact Mass | 451.01 |
| IUPAC Name | 4-[[5-bromo-4-[(4-fluorophenyl)methylamino]pyrimidin-2-yl]amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Nc2ncc(Br)c(NCc3ccc(F)cc3)n2)cc1 |
| InChI | InChI=1S/C17H15BrFN5O2S/c18-15-10-22-17(23-13-5-7-14(8-6-13)27(20,25)26)24-16(15)21-9-11-1-3-12(19)4-2-11/h1-8,10H,9H2,(H2,20,25,26)(H2,21,22,23,24) |
| InChIKey | ACZDAHXHLOAGRC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |