C14H16BrN5O3S — CID 58891201
4-[[5-bromo-4-[[(3S)-oxolan-3-yl]amino]pyrimidin-2-yl]amino]benzenesulfonamide (PubChem CID 58891201) has the molecular formula C14H16BrN5O3S and a molecular weight of 414.29 g/mol. Its IUPAC name is 4-[[5-bromo-4-[[(3S)-oxolan-3-yl]amino]pyrimidin-2-yl]amino]benzenesulfonamide.
| Compound Name | 4-[[5-bromo-4-[[(3S)-oxolan-3-yl]amino]pyrimidin-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 58891201 |
| Molecular Formula | C14H16BrN5O3S |
| Molecular Weight | 414.29 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | 4-[[5-bromo-4-[[(3S)-oxolan-3-yl]amino]pyrimidin-2-yl]amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Nc2ncc(Br)c(N[C@H]3CCOC3)n2)cc1 |
| InChI | InChI=1S/C14H16BrN5O3S/c15-12-7-17-14(20-13(12)18-10-5-6-23-8-10)19-9-1-3-11(4-2-9)24(16,21)22/h1-4,7,10H,5-6,8H2,(H2,16,21,22)(H2,17,18,19,20)/t10-/m0/s1 |
| InChIKey | BVQPZAIXEHOTTK-JTQLQIEISA-N |
| XLogP | 1.83 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |