C17H23N5O2S — CID 142188527
4-[[4-(cyclohexylamino)-5-methylpyrimidin-2-yl]amino]benzenesulfonamide (PubChem CID 142188527) has the molecular formula C17H23N5O2S and a molecular weight of 361.47 g/mol. Its IUPAC name is 4-[[4-(cyclohexylamino)-5-methylpyrimidin-2-yl]amino]benzenesulfonamide.
| Compound Name | 4-[[4-(cyclohexylamino)-5-methylpyrimidin-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 142188527 |
| Molecular Formula | C17H23N5O2S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 4-[[4-(cyclohexylamino)-5-methylpyrimidin-2-yl]amino]benzenesulfonamide |
| SMILES | Cc1cnc(Nc2ccc(S(N)(=O)=O)cc2)nc1NC1CCCCC1 |
| InChI | InChI=1S/C17H23N5O2S/c1-12-11-19-17(22-16(12)20-13-5-3-2-4-6-13)21-14-7-9-15(10-8-14)25(18,23)24/h7-11,13H,2-6H2,1H3,(H2,18,23,24)(H2,19,20,21,22) |
| InChIKey | CAYBAZZXMFJEPM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |