C19H19N7O2S — CID 67047282
4-[[5-methyl-4-[(1-methylindazol-5-yl)amino]pyrimidin-2-yl]amino]benzenesulfonamide (PubChem CID 67047282) has the molecular formula C19H19N7O2S and a molecular weight of 409.48 g/mol. Its IUPAC name is 4-[[5-methyl-4-[(1-methylindazol-5-yl)amino]pyrimidin-2-yl]amino]benzenesulfonamide.
| Compound Name | 4-[[5-methyl-4-[(1-methylindazol-5-yl)amino]pyrimidin-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 67047282 |
| Molecular Formula | C19H19N7O2S |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 4-[[5-methyl-4-[(1-methylindazol-5-yl)amino]pyrimidin-2-yl]amino]benzenesulfonamide |
| SMILES | Cc1cnc(Nc2ccc(S(N)(=O)=O)cc2)nc1Nc1ccc2c(cnn2C)c1 |
| InChI | InChI=1S/C19H19N7O2S/c1-12-10-21-19(24-14-3-6-16(7-4-14)29(20,27)28)25-18(12)23-15-5-8-17-13(9-15)11-22-26(17)2/h3-11H,1-2H3,(H2,20,27,28)(H2,21,23,24,25) |
| InChIKey | PSKAHUSESSNASJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |