C16H19N7O2S — CID 68820842
4-[[4-(2-imidazol-1-ylethylamino)-5-methylpyrimidin-2-yl]amino]benzenesulfonamide (PubChem CID 68820842) has the molecular formula C16H19N7O2S and a molecular weight of 373.44 g/mol. Its IUPAC name is 4-[[4-(2-imidazol-1-ylethylamino)-5-methylpyrimidin-2-yl]amino]benzenesulfonamide.
| Compound Name | 4-[[4-(2-imidazol-1-ylethylamino)-5-methylpyrimidin-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 68820842 |
| Molecular Formula | C16H19N7O2S |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 4-[[4-(2-imidazol-1-ylethylamino)-5-methylpyrimidin-2-yl]amino]benzenesulfonamide |
| SMILES | Cc1cnc(Nc2ccc(S(N)(=O)=O)cc2)nc1NCCn1ccnc1 |
| InChI | InChI=1S/C16H19N7O2S/c1-12-10-20-16(21-13-2-4-14(5-3-13)26(17,24)25)22-15(12)19-7-9-23-8-6-18-11-23/h2-6,8,10-11H,7,9H2,1H3,(H2,17,24,25)(H2,19,20,21,22) |
| InChIKey | NLBFAZNNKVMMLZ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |