C22H22N6O — CID 117089740
4-[2-[[2-(4-imidazol-1-ylanilino)-5-methylpyrimidin-4-yl]amino]ethyl]phenol (PubChem CID 117089740) has the molecular formula C22H22N6O and a molecular weight of 386.46 g/mol. Its IUPAC name is 4-[2-[[2-(4-imidazol-1-ylanilino)-5-methylpyrimidin-4-yl]amino]ethyl]phenol.
| Compound Name | 4-[2-[[2-(4-imidazol-1-ylanilino)-5-methylpyrimidin-4-yl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 117089740 |
| Molecular Formula | C22H22N6O |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 4-[2-[[2-(4-imidazol-1-ylanilino)-5-methylpyrimidin-4-yl]amino]ethyl]phenol |
| SMILES | Cc1cnc(Nc2ccc(-n3ccnc3)cc2)nc1NCCc1ccc(O)cc1 |
| InChI | InChI=1S/C22H22N6O/c1-16-14-25-22(26-18-4-6-19(7-5-18)28-13-12-23-15-28)27-21(16)24-11-10-17-2-8-20(29)9-3-17/h2-9,12-15,29H,10-11H2,1H3,(H2,24,25,26,27) |
| InChIKey | SWSFNKFROLAKLB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |