C21H20N6O — CID 117085289
4-[2-[[2-(4-imidazol-1-ylanilino)pyrimidin-4-yl]amino]ethyl]phenol (PubChem CID 117085289) has the molecular formula C21H20N6O and a molecular weight of 372.43 g/mol. Its IUPAC name is 4-[2-[[2-(4-imidazol-1-ylanilino)pyrimidin-4-yl]amino]ethyl]phenol.
| Compound Name | 4-[2-[[2-(4-imidazol-1-ylanilino)pyrimidin-4-yl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 117085289 |
| Molecular Formula | C21H20N6O |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 4-[2-[[2-(4-imidazol-1-ylanilino)pyrimidin-4-yl]amino]ethyl]phenol |
| SMILES | Oc1ccc(CCNc2ccnc(Nc3ccc(-n4ccnc4)cc3)n2)cc1 |
| InChI | InChI=1S/C21H20N6O/c28-19-7-1-16(2-8-19)9-11-23-20-10-12-24-21(26-20)25-17-3-5-18(6-4-17)27-14-13-22-15-27/h1-8,10,12-15,28H,9,11H2,(H2,23,24,25,26) |
| InChIKey | DVLGRMNKPMJAIT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |