C40H38N12O2 — CID 11181674
4-[2-[[4-anilino-6-[4-[[4-anilino-6-[2-(4-hydroxyphenyl)ethylamino]-1,3,5-triazin-2-yl]amino]anilino]-1,3,5-triazin-2-yl]amino]ethyl]phenol (PubChem CID 11181674) has the molecular formula C40H38N12O2 and a molecular weight of 718.83 g/mol. Its IUPAC name is 4-[2-[[4-anilino-6-[4-[[4-anilino-6-[2-(4-hydroxyphenyl)ethylamino]-1,3,5-triazin-2-yl]amino]anilino]-1,3,5-triazin-2-yl]amino]ethyl]phenol.
| Compound Name | 4-[2-[[4-anilino-6-[4-[[4-anilino-6-[2-(4-hydroxyphenyl)ethylamino]-1,3,5-triazin-2-yl]amino]anilino]-1,3,5-triazin-2-yl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 11181674 |
| Molecular Formula | C40H38N12O2 |
| Molecular Weight | 718.83 g/mol |
| Exact Mass | 718.32 |
| IUPAC Name | 4-[2-[[4-anilino-6-[4-[[4-anilino-6-[2-(4-hydroxyphenyl)ethylamino]-1,3,5-triazin-2-yl]amino]anilino]-1,3,5-triazin-2-yl]amino]ethyl]phenol |
| SMILES | Oc1ccc(CCNc2nc(Nc3ccccc3)nc(Nc3ccc(Nc4nc(NCCc5ccc(O)cc5)nc(Nc5ccccc5)n4)cc3)n2)cc1 |
| InChI | InChI=1S/C40H38N12O2/c53-33-19-11-27(12-20-33)23-25-41-35-47-37(43-29-7-3-1-4-8-29)51-39(49-35)45-31-15-17-32(18-16-31)46-40-50-36(42-26-24-28-13-21-34(54)22-14-28)48-38(52-40)44-30-9-5-2-6-10-30/h1-22,53-54H,23-26H2,(H3,41,43,45,47,49,51)(H3,42,44,46,48,50,52) |
| InChIKey | KDROSXMVZRKJFM-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 189.98 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.83 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |