C36H38N12O2 — CID 11445284
4-[2-[[4-anilino-6-[2-[[4-anilino-6-[2-(4-hydroxyphenyl)ethylamino]-1,3,5-triazin-2-yl]amino]ethylamino]-1,3,5-triazin-2-yl]amino]ethyl]phenol (PubChem CID 11445284) has the molecular formula C36H38N12O2 and a molecular weight of 670.78 g/mol. Its IUPAC name is 4-[2-[[4-anilino-6-[2-[[4-anilino-6-[2-(4-hydroxyphenyl)ethylamino]-1,3,5-triazin-2-yl]amino]ethylamino]-1,3,5-triazin-2-yl]amino]ethyl]phenol.
| Compound Name | 4-[2-[[4-anilino-6-[2-[[4-anilino-6-[2-(4-hydroxyphenyl)ethylamino]-1,3,5-triazin-2-yl]amino]ethylamino]-1,3,5-triazin-2-yl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 11445284 |
| Molecular Formula | C36H38N12O2 |
| Molecular Weight | 670.78 g/mol |
| Exact Mass | 670.32 |
| IUPAC Name | 4-[2-[[4-anilino-6-[2-[[4-anilino-6-[2-(4-hydroxyphenyl)ethylamino]-1,3,5-triazin-2-yl]amino]ethylamino]-1,3,5-triazin-2-yl]amino]ethyl]phenol |
| SMILES | Oc1ccc(CCNc2nc(NCCNc3nc(NCCc4ccc(O)cc4)nc(Nc4ccccc4)n3)nc(Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C36H38N12O2/c49-29-15-11-25(12-16-29)19-21-37-31-43-33(47-35(45-31)41-27-7-3-1-4-8-27)39-23-24-40-34-44-32(38-22-20-26-13-17-30(50)18-14-26)46-36(48-34)42-28-9-5-2-6-10-28/h1-18,49-50H,19-24H2,(H3,37,39,41,43,45,47)(H3,38,40,42,44,46,48) |
| InChIKey | KGTBXBPPEXEGFF-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 189.98 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.78 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|