C14H15Cl2N10P — CID 118921034
6-chloro-4-N-[2-[[4-chloro-6-(phosphanylamino)-1,3,5-triazin-2-yl]amino]ethyl]-2-N-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 118921034) has the molecular formula C14H15Cl2N10P and a molecular weight of 425.22 g/mol. Its IUPAC name is 6-chloro-4-N-[2-[[4-chloro-6-(phosphanylamino)-1,3,5-triazin-2-yl]amino]ethyl]-2-N-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-4-N-[2-[[4-chloro-6-(phosphanylamino)-1,3,5-triazin-2-yl]amino]ethyl]-2-N-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 118921034 |
| Molecular Formula | C14H15Cl2N10P |
| Molecular Weight | 425.22 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | 6-chloro-4-N-[2-[[4-chloro-6-(phosphanylamino)-1,3,5-triazin-2-yl]amino]ethyl]-2-N-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | PNc1nc(Cl)nc(NCCNc2nc(Cl)nc(Nc3ccccc3)n2)n1 |
| InChI | InChI=1S/C14H15Cl2N10P/c15-9-20-11(24-13(22-9)19-8-4-2-1-3-5-8)17-6-7-18-12-21-10(16)23-14(25-12)26-27/h1-5H,6-7,27H2,(H2,17,19,20,22,24)(H2,18,21,23,25,26) |
| InChIKey | YSOUMCBJEHCECW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.22 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|