C35H36N12 — CID 20775300
6-N-[5-[(4,6-dianilino-1,3,5-triazin-2-yl)amino]pentyl]-2-N,4-N-diphenyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 20775300) has the molecular formula C35H36N12 and a molecular weight of 624.76 g/mol. Its IUPAC name is 6-N-[5-[(4,6-dianilino-1,3,5-triazin-2-yl)amino]pentyl]-2-N,4-N-diphenyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-[5-[(4,6-dianilino-1,3,5-triazin-2-yl)amino]pentyl]-2-N,4-N-diphenyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 20775300 |
| Molecular Formula | C35H36N12 |
| Molecular Weight | 624.76 g/mol |
| Exact Mass | 624.32 |
| IUPAC Name | 6-N-[5-[(4,6-dianilino-1,3,5-triazin-2-yl)amino]pentyl]-2-N,4-N-diphenyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | c1ccc(Nc2nc(NCCCCCNc3nc(Nc4ccccc4)nc(Nc4ccccc4)n3)nc(Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C35H36N12/c1-6-16-26(17-7-1)38-32-42-30(43-33(46-32)39-27-18-8-2-9-19-27)36-24-14-5-15-25-37-31-44-34(40-28-20-10-3-11-21-28)47-35(45-31)41-29-22-12-4-13-23-29/h1-4,6-13,16-23H,5,14-15,24-25H2,(H3,36,38,39,42,43,46)(H3,37,40,41,44,45,47) |
| InChIKey | ISLTZMOJMLHUJO-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 149.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.76 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|