C37H41N13O — CID 11490897
4-[2-[[4-[4-[2-[[4-(3-aminopropylamino)-6-anilino-1,3,5-triazin-2-yl]amino]ethyl]anilino]-6-anilino-1,3,5-triazin-2-yl]amino]ethyl]phenol (PubChem CID 11490897) has the molecular formula C37H41N13O and a molecular weight of 683.83 g/mol. Its IUPAC name is 4-[2-[[4-[4-[2-[[4-(3-aminopropylamino)-6-anilino-1,3,5-triazin-2-yl]amino]ethyl]anilino]-6-anilino-1,3,5-triazin-2-yl]amino]ethyl]phenol.
| Compound Name | 4-[2-[[4-[4-[2-[[4-(3-aminopropylamino)-6-anilino-1,3,5-triazin-2-yl]amino]ethyl]anilino]-6-anilino-1,3,5-triazin-2-yl]amino]ethyl]phenol |
|---|---|
| PubChem CID | 11490897 |
| Molecular Formula | C37H41N13O |
| Molecular Weight | 683.83 g/mol |
| Exact Mass | 683.36 |
| IUPAC Name | 4-[2-[[4-[4-[2-[[4-(3-aminopropylamino)-6-anilino-1,3,5-triazin-2-yl]amino]ethyl]anilino]-6-anilino-1,3,5-triazin-2-yl]amino]ethyl]phenol |
| SMILES | NCCCNc1nc(NCCc2ccc(Nc3nc(NCCc4ccc(O)cc4)nc(Nc4ccccc4)n3)cc2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C37H41N13O/c38-22-7-23-39-32-45-33(47-35(46-32)42-28-8-3-1-4-9-28)40-24-20-26-12-16-30(17-13-26)44-37-49-34(41-25-21-27-14-18-31(51)19-15-27)48-36(50-37)43-29-10-5-2-6-11-29/h1-6,8-19,51H,7,20-25,38H2,(H3,39,40,42,45,46,47)(H3,41,43,44,48,49,50) |
| InChIKey | USYNTZNJKYIUHI-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 195.77 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.83 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|