C20H23FN6O — CID 134135652
5-[[4-anilino-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]amino]pentan-1-ol (PubChem CID 134135652) has the molecular formula C20H23FN6O and a molecular weight of 382.44 g/mol. Its IUPAC name is 5-[[4-anilino-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]amino]pentan-1-ol.
| Compound Name | 5-[[4-anilino-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]amino]pentan-1-ol |
|---|---|
| PubChem CID | 134135652 |
| Molecular Formula | C20H23FN6O |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 5-[[4-anilino-6-(4-fluoroanilino)-1,3,5-triazin-2-yl]amino]pentan-1-ol |
| SMILES | OCCCCCNc1nc(Nc2ccccc2)nc(Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C20H23FN6O/c21-15-9-11-17(12-10-15)24-20-26-18(22-13-5-2-6-14-28)25-19(27-20)23-16-7-3-1-4-8-16/h1,3-4,7-12,28H,2,5-6,13-14H2,(H3,22,23,24,25,26,27) |
| InChIKey | NAIHOFITDDRWNO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|