C19H18ClF2N5 — CID 142437860
6-chloro-4-N-(4-fluorobutyl)-2-N-[4-(4-fluorophenyl)phenyl]-1,3,5-triazine-2,4-diamine (PubChem CID 142437860) has the molecular formula C19H18ClF2N5 and a molecular weight of 389.84 g/mol. Its IUPAC name is 6-chloro-4-N-(4-fluorobutyl)-2-N-[4-(4-fluorophenyl)phenyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-4-N-(4-fluorobutyl)-2-N-[4-(4-fluorophenyl)phenyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 142437860 |
| Molecular Formula | C19H18ClF2N5 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 6-chloro-4-N-(4-fluorobutyl)-2-N-[4-(4-fluorophenyl)phenyl]-1,3,5-triazine-2,4-diamine |
| SMILES | FCCCCNc1nc(Cl)nc(Nc2ccc(-c3ccc(F)cc3)cc2)n1 |
| InChI | InChI=1S/C19H18ClF2N5/c20-17-25-18(23-12-2-1-11-21)27-19(26-17)24-16-9-5-14(6-10-16)13-3-7-15(22)8-4-13/h3-10H,1-2,11-12H2,(H2,23,24,25,26,27) |
| InChIKey | AUPFXKVXLPSWIL-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|