C30H28F12N10O2 — CID 3094597
6-N-[4-[[4,6-bis(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazin-2-yl]amino]butyl]-2-N,4-N-bis(4-methylphenyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 3094597) has the molecular formula C30H28F12N10O2 and a molecular weight of 788.60 g/mol. Its IUPAC name is 6-N-[4-[[4,6-bis(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazin-2-yl]amino]butyl]-2-N,4-N-bis(4-methylphenyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-[4-[[4,6-bis(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazin-2-yl]amino]butyl]-2-N,4-N-bis(4-methylphenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 3094597 |
| Molecular Formula | C30H28F12N10O2 |
| Molecular Weight | 788.60 g/mol |
| Exact Mass | 788.22 |
| IUPAC Name | 6-N-[4-[[4,6-bis(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazin-2-yl]amino]butyl]-2-N,4-N-bis(4-methylphenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | Cc1ccc(Nc2nc(NCCCCNc3nc(OC(C(F)(F)F)C(F)(F)F)nc(OC(C(F)(F)F)C(F)(F)F)n3)nc(Nc3ccc(C)cc3)n2)cc1 |
| InChI | InChI=1S/C30H28F12N10O2/c1-15-5-9-17(10-6-15)45-23-47-21(48-24(49-23)46-18-11-7-16(2)8-12-18)43-13-3-4-14-44-22-50-25(53-19(27(31,32)33)28(34,35)36)52-26(51-22)54-20(29(37,38)39)30(40,41)42/h5-12,19-20H,3-4,13-14H2,1-2H3,(H,44,50,51,52)(H3,43,45,46,47,48,49) |
| InChIKey | LYHUNYXBVHVPQT-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 143.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.60 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|