C16H13F9N4O2 — CID 146553735
4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-(4-methylphenyl)-6-(1,1,1-trifluoropropan-2-yloxy)-1,3,5-triazin-2-amine (PubChem CID 146553735) has the molecular formula C16H13F9N4O2 and a molecular weight of 464.29 g/mol. Its IUPAC name is 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-(4-methylphenyl)-6-(1,1,1-trifluoropropan-2-yloxy)-1,3,5-triazin-2-amine.
| Compound Name | 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-(4-methylphenyl)-6-(1,1,1-trifluoropropan-2-yloxy)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 146553735 |
| Molecular Formula | C16H13F9N4O2 |
| Molecular Weight | 464.29 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | 4-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-(4-methylphenyl)-6-(1,1,1-trifluoropropan-2-yloxy)-1,3,5-triazin-2-amine |
| SMILES | Cc1ccc(Nc2nc(OC(C)C(F)(F)F)nc(OC(C(F)(F)F)C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C16H13F9N4O2/c1-7-3-5-9(6-4-7)26-11-27-12(30-8(2)14(17,18)19)29-13(28-11)31-10(15(20,21)22)16(23,24)25/h3-6,8,10H,1-2H3,(H,26,27,28,29) |
| InChIKey | LIMIBQQOFMACJQ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.29 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |