C19H21F6N5O2 — CID 129304826
2-N-cyclohexyl-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-(4-methoxyphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 129304826) has the molecular formula C19H21F6N5O2 and a molecular weight of 465.40 g/mol. Its IUPAC name is 2-N-cyclohexyl-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-(4-methoxyphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-cyclohexyl-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-(4-methoxyphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 129304826 |
| Molecular Formula | C19H21F6N5O2 |
| Molecular Weight | 465.40 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 2-N-cyclohexyl-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-N-(4-methoxyphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | COc1ccc(Nc2nc(NC3CCCCC3)nc(OC(C(F)(F)F)C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C19H21F6N5O2/c1-31-13-9-7-12(8-10-13)27-16-28-15(26-11-5-3-2-4-6-11)29-17(30-16)32-14(18(20,21)22)19(23,24)25/h7-11,14H,2-6H2,1H3,(H2,26,27,28,29,30) |
| InChIKey | LLCIAMUQDCIZHF-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.40 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |