C17H23N5O — CID 112959185
5-N-cycloheptyl-3-N-(4-methoxyphenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112959185) has the molecular formula C17H23N5O and a molecular weight of 313.40 g/mol. Its IUPAC name is 5-N-cycloheptyl-3-N-(4-methoxyphenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-cycloheptyl-3-N-(4-methoxyphenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112959185 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 5-N-cycloheptyl-3-N-(4-methoxyphenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | COc1ccc(Nc2nncc(NC3CCCCCC3)n2)cc1 |
| InChI | InChI=1S/C17H23N5O/c1-23-15-10-8-14(9-11-15)20-17-21-16(12-18-22-17)19-13-6-4-2-3-5-7-13/h8-13H,2-7H2,1H3,(H2,19,20,21,22) |
| InChIKey | XKLVNTYDHDKOND-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |