C17H23N5O2 — CID 112942501
3-N-cyclohexyl-5-N-(2,4-dimethoxyphenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112942501) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-N-cyclohexyl-5-N-(2,4-dimethoxyphenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-cyclohexyl-5-N-(2,4-dimethoxyphenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112942501 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 3-N-cyclohexyl-5-N-(2,4-dimethoxyphenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | COc1ccc(Nc2cnnc(NC3CCCCC3)n2)c(OC)c1 |
| InChI | InChI=1S/C17H23N5O2/c1-23-13-8-9-14(15(10-13)24-2)20-16-11-18-22-17(21-16)19-12-6-4-3-5-7-12/h8-12H,3-7H2,1-2H3,(H2,19,20,21,22) |
| InChIKey | UGAQCBNUNJIGEU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |