C15H17Cl2N5 — CID 112942542
3-N-cyclohexyl-5-N-(2,4-dichlorophenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112942542) has the molecular formula C15H17Cl2N5 and a molecular weight of 338.24 g/mol. Its IUPAC name is 3-N-cyclohexyl-5-N-(2,4-dichlorophenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-cyclohexyl-5-N-(2,4-dichlorophenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112942542 |
| Molecular Formula | C15H17Cl2N5 |
| Molecular Weight | 338.24 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 3-N-cyclohexyl-5-N-(2,4-dichlorophenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | Clc1ccc(Nc2cnnc(NC3CCCCC3)n2)c(Cl)c1 |
| InChI | InChI=1S/C15H17Cl2N5/c16-10-6-7-13(12(17)8-10)20-14-9-18-22-15(21-14)19-11-4-2-1-3-5-11/h6-9,11H,1-5H2,(H2,19,20,21,22) |
| InChIKey | AYZAZRQWUZAHTQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.24 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |