C20H23N5O4 — CID 112958785
5-N-(2,4-dimethoxyphenyl)-3-N-[2-(4-methoxyphenoxy)ethyl]-1,2,4-triazine-3,5-diamine (PubChem CID 112958785) has the molecular formula C20H23N5O4 and a molecular weight of 397.44 g/mol. Its IUPAC name is 5-N-(2,4-dimethoxyphenyl)-3-N-[2-(4-methoxyphenoxy)ethyl]-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-(2,4-dimethoxyphenyl)-3-N-[2-(4-methoxyphenoxy)ethyl]-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112958785 |
| Molecular Formula | C20H23N5O4 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 5-N-(2,4-dimethoxyphenyl)-3-N-[2-(4-methoxyphenoxy)ethyl]-1,2,4-triazine-3,5-diamine |
| SMILES | COc1ccc(OCCNc2nncc(Nc3ccc(OC)cc3OC)n2)cc1 |
| InChI | InChI=1S/C20H23N5O4/c1-26-14-4-6-15(7-5-14)29-11-10-21-20-24-19(13-22-25-20)23-17-9-8-16(27-2)12-18(17)28-3/h4-9,12-13H,10-11H2,1-3H3,(H2,21,23,24,25) |
| InChIKey | VBUQCYSGZGPEBK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|