C18H18FN5O2 — CID 112958765
5-N-(2-fluorophenyl)-3-N-[2-(4-methoxyphenoxy)ethyl]-1,2,4-triazine-3,5-diamine (PubChem CID 112958765) has the molecular formula C18H18FN5O2 and a molecular weight of 355.37 g/mol. Its IUPAC name is 5-N-(2-fluorophenyl)-3-N-[2-(4-methoxyphenoxy)ethyl]-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-(2-fluorophenyl)-3-N-[2-(4-methoxyphenoxy)ethyl]-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112958765 |
| Molecular Formula | C18H18FN5O2 |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 5-N-(2-fluorophenyl)-3-N-[2-(4-methoxyphenoxy)ethyl]-1,2,4-triazine-3,5-diamine |
| SMILES | COc1ccc(OCCNc2nncc(Nc3ccccc3F)n2)cc1 |
| InChI | InChI=1S/C18H18FN5O2/c1-25-13-6-8-14(9-7-13)26-11-10-20-18-23-17(12-21-24-18)22-16-5-3-2-4-15(16)19/h2-9,12H,10-11H2,1H3,(H2,20,22,23,24) |
| InChIKey | BMYPZAIBYUPESB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|