C13H14F3N5O — CID 112943606
3-N-(2-methoxyethyl)-5-N-[2-(trifluoromethyl)phenyl]-1,2,4-triazine-3,5-diamine (PubChem CID 112943606) has the molecular formula C13H14F3N5O and a molecular weight of 313.28 g/mol. Its IUPAC name is 3-N-(2-methoxyethyl)-5-N-[2-(trifluoromethyl)phenyl]-1,2,4-triazine-3,5-diamine.
| Compound Name | 3-N-(2-methoxyethyl)-5-N-[2-(trifluoromethyl)phenyl]-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112943606 |
| Molecular Formula | C13H14F3N5O |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 3-N-(2-methoxyethyl)-5-N-[2-(trifluoromethyl)phenyl]-1,2,4-triazine-3,5-diamine |
| SMILES | COCCNc1nncc(Nc2ccccc2C(F)(F)F)n1 |
| InChI | InChI=1S/C13H14F3N5O/c1-22-7-6-17-12-20-11(8-18-21-12)19-10-5-3-2-4-9(10)13(14,15)16/h2-5,8H,6-7H2,1H3,(H2,17,19,20,21) |
| InChIKey | DJWFZMCZSADIBA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|