C15H19N5O4S — CID 112955032
5-N-(2,5-dimethoxyphenyl)-3-N-(1,1-dioxothiolan-3-yl)-1,2,4-triazine-3,5-diamine (PubChem CID 112955032) has the molecular formula C15H19N5O4S and a molecular weight of 365.42 g/mol. Its IUPAC name is 5-N-(2,5-dimethoxyphenyl)-3-N-(1,1-dioxothiolan-3-yl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-(2,5-dimethoxyphenyl)-3-N-(1,1-dioxothiolan-3-yl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112955032 |
| Molecular Formula | C15H19N5O4S |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 5-N-(2,5-dimethoxyphenyl)-3-N-(1,1-dioxothiolan-3-yl)-1,2,4-triazine-3,5-diamine |
| SMILES | COc1ccc(OC)c(Nc2cnnc(NC3CCS(=O)(=O)C3)n2)c1 |
| InChI | InChI=1S/C15H19N5O4S/c1-23-11-3-4-13(24-2)12(7-11)18-14-8-16-20-15(19-14)17-10-5-6-25(21,22)9-10/h3-4,7-8,10H,5-6,9H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | KJGXQJUVWNGFOT-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |