C17H23N5O4S — CID 112956833
5-N-(2,5-dimethoxyphenyl)-3-N-(1,1-dioxothiolan-3-yl)-3-N-ethyl-1,2,4-triazine-3,5-diamine (PubChem CID 112956833) has the molecular formula C17H23N5O4S and a molecular weight of 393.47 g/mol. Its IUPAC name is 5-N-(2,5-dimethoxyphenyl)-3-N-(1,1-dioxothiolan-3-yl)-3-N-ethyl-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-(2,5-dimethoxyphenyl)-3-N-(1,1-dioxothiolan-3-yl)-3-N-ethyl-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112956833 |
| Molecular Formula | C17H23N5O4S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 5-N-(2,5-dimethoxyphenyl)-3-N-(1,1-dioxothiolan-3-yl)-3-N-ethyl-1,2,4-triazine-3,5-diamine |
| SMILES | CCN(c1nncc(Nc2cc(OC)ccc2OC)n1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H23N5O4S/c1-4-22(12-7-8-27(23,24)11-12)17-20-16(10-18-21-17)19-14-9-13(25-2)5-6-15(14)26-3/h5-6,9-10,12H,4,7-8,11H2,1-3H3,(H,19,20,21) |
| InChIKey | FSKQWBBGQWTZLZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |