C16H21N5O4S — CID 112955270
5-N-(3,4-dimethoxyphenyl)-3-N-(1,1-dioxothiolan-3-yl)-3-N-methyl-1,2,4-triazine-3,5-diamine (PubChem CID 112955270) has the molecular formula C16H21N5O4S and a molecular weight of 379.44 g/mol. Its IUPAC name is 5-N-(3,4-dimethoxyphenyl)-3-N-(1,1-dioxothiolan-3-yl)-3-N-methyl-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-(3,4-dimethoxyphenyl)-3-N-(1,1-dioxothiolan-3-yl)-3-N-methyl-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112955270 |
| Molecular Formula | C16H21N5O4S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 5-N-(3,4-dimethoxyphenyl)-3-N-(1,1-dioxothiolan-3-yl)-3-N-methyl-1,2,4-triazine-3,5-diamine |
| SMILES | COc1ccc(Nc2cnnc(N(C)C3CCS(=O)(=O)C3)n2)cc1OC |
| InChI | InChI=1S/C16H21N5O4S/c1-21(12-6-7-26(22,23)10-12)16-19-15(9-17-20-16)18-11-4-5-13(24-2)14(8-11)25-3/h4-5,8-9,12H,6-7,10H2,1-3H3,(H,18,19,20) |
| InChIKey | ZQTPUEFDZDEPBG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |