C15H18FN5 — CID 112942291
5-N-cyclohexyl-3-N-(4-fluorophenyl)-1,2,4-triazine-3,5-diamine (PubChem CID 112942291) has the molecular formula C15H18FN5 and a molecular weight of 287.34 g/mol. Its IUPAC name is 5-N-cyclohexyl-3-N-(4-fluorophenyl)-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-cyclohexyl-3-N-(4-fluorophenyl)-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112942291 |
| Molecular Formula | C15H18FN5 |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 5-N-cyclohexyl-3-N-(4-fluorophenyl)-1,2,4-triazine-3,5-diamine |
| SMILES | Fc1ccc(Nc2nncc(NC3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C15H18FN5/c16-11-6-8-13(9-7-11)19-15-20-14(10-17-21-15)18-12-4-2-1-3-5-12/h6-10,12H,1-5H2,(H2,18,19,20,21) |
| InChIKey | XTCYCMJOHCSCBY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |