C15H16N6 — CID 112941608
4-[[5-(cyclopentylamino)-1,2,4-triazin-3-yl]amino]benzonitrile (PubChem CID 112941608) has the molecular formula C15H16N6 and a molecular weight of 280.34 g/mol. Its IUPAC name is 4-[[5-(cyclopentylamino)-1,2,4-triazin-3-yl]amino]benzonitrile.
| Compound Name | 4-[[5-(cyclopentylamino)-1,2,4-triazin-3-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112941608 |
| Molecular Formula | C15H16N6 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 4-[[5-(cyclopentylamino)-1,2,4-triazin-3-yl]amino]benzonitrile |
| SMILES | N#Cc1ccc(Nc2nncc(NC3CCCC3)n2)cc1 |
| InChI | InChI=1S/C15H16N6/c16-9-11-5-7-13(8-6-11)19-15-20-14(10-17-21-15)18-12-3-1-2-4-12/h5-8,10,12H,1-4H2,(H2,18,19,20,21) |
| InChIKey | TUTNQNCVLIIKIN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |