C22H21N5 — CID 112934407
4-[[4-(cyclopentylamino)-6-phenylpyrimidin-2-yl]amino]benzonitrile (PubChem CID 112934407) has the molecular formula C22H21N5 and a molecular weight of 355.45 g/mol. Its IUPAC name is 4-[[4-(cyclopentylamino)-6-phenylpyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-(cyclopentylamino)-6-phenylpyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112934407 |
| Molecular Formula | C22H21N5 |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 4-[[4-(cyclopentylamino)-6-phenylpyrimidin-2-yl]amino]benzonitrile |
| SMILES | N#Cc1ccc(Nc2nc(NC3CCCC3)cc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C22H21N5/c23-15-16-10-12-19(13-11-16)25-22-26-20(17-6-2-1-3-7-17)14-21(27-22)24-18-8-4-5-9-18/h1-3,6-7,10-14,18H,4-5,8-9H2,(H2,24,25,26,27) |
| InChIKey | UDEBAWIDKVBKDV-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |