C20H17N5 — CID 112879566
4-[[6-(cyclopropylamino)-2-phenylpyrimidin-4-yl]amino]benzonitrile (PubChem CID 112879566) has the molecular formula C20H17N5 and a molecular weight of 327.39 g/mol. Its IUPAC name is 4-[[6-(cyclopropylamino)-2-phenylpyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 4-[[6-(cyclopropylamino)-2-phenylpyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112879566 |
| Molecular Formula | C20H17N5 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 4-[[6-(cyclopropylamino)-2-phenylpyrimidin-4-yl]amino]benzonitrile |
| SMILES | N#Cc1ccc(Nc2cc(NC3CC3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C20H17N5/c21-13-14-6-8-16(9-7-14)22-18-12-19(23-17-10-11-17)25-20(24-18)15-4-2-1-3-5-15/h1-9,12,17H,10-11H2,(H2,22,23,24,25) |
| InChIKey | SLCCZIQOFOKASJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |