C23H24N4O — CID 112880079
1-[4-[[6-(cyclopentylamino)-2-phenylpyrimidin-4-yl]amino]phenyl]ethanone (PubChem CID 112880079) has the molecular formula C23H24N4O and a molecular weight of 372.47 g/mol. Its IUPAC name is 1-[4-[[6-(cyclopentylamino)-2-phenylpyrimidin-4-yl]amino]phenyl]ethanone.
| Compound Name | 1-[4-[[6-(cyclopentylamino)-2-phenylpyrimidin-4-yl]amino]phenyl]ethanone |
|---|---|
| PubChem CID | 112880079 |
| Molecular Formula | C23H24N4O |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 1-[4-[[6-(cyclopentylamino)-2-phenylpyrimidin-4-yl]amino]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(Nc2cc(NC3CCCC3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H24N4O/c1-16(28)17-11-13-20(14-12-17)25-22-15-21(24-19-9-5-6-10-19)26-23(27-22)18-7-3-2-4-8-18/h2-4,7-8,11-15,19H,5-6,9-10H2,1H3,(H2,24,25,26,27) |
| InChIKey | FWHWCEBDYUEUKE-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |