C20H24N6O — CID 16910827
2-N-cycloheptyl-4-N-(4-methoxyphenyl)pteridine-2,4-diamine (PubChem CID 16910827) has the molecular formula C20H24N6O and a molecular weight of 364.45 g/mol. Its IUPAC name is 2-N-cycloheptyl-4-N-(4-methoxyphenyl)pteridine-2,4-diamine.
| Compound Name | 2-N-cycloheptyl-4-N-(4-methoxyphenyl)pteridine-2,4-diamine |
|---|---|
| PubChem CID | 16910827 |
| Molecular Formula | C20H24N6O |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 2-N-cycloheptyl-4-N-(4-methoxyphenyl)pteridine-2,4-diamine |
| SMILES | COc1ccc(Nc2nc(NC3CCCCCC3)nc3nccnc23)cc1 |
| InChI | InChI=1S/C20H24N6O/c1-27-16-10-8-15(9-11-16)23-19-17-18(22-13-12-21-17)25-20(26-19)24-14-6-4-2-3-5-7-14/h8-14H,2-7H2,1H3,(H2,22,23,24,25,26) |
| InChIKey | OXFBOAZWJVZAPP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 84.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |