C21H25ClN4O — CID 67718532
2-N-cyclohexyl-8-methoxy-4-N-phenylquinazoline-2,4-diamine;hydrochloride (PubChem CID 67718532) has the molecular formula C21H25ClN4O and a molecular weight of 384.91 g/mol. Its IUPAC name is 2-N-cyclohexyl-8-methoxy-4-N-phenylquinazoline-2,4-diamine;hydrochloride.
| Compound Name | 2-N-cyclohexyl-8-methoxy-4-N-phenylquinazoline-2,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 67718532 |
| Molecular Formula | C21H25ClN4O |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 2-N-cyclohexyl-8-methoxy-4-N-phenylquinazoline-2,4-diamine;hydrochloride |
| SMILES | COc1cccc2c(Nc3ccccc3)nc(NC3CCCCC3)nc12.Cl |
| InChI | InChI=1S/C21H24N4O.ClH/c1-26-18-14-8-13-17-19(18)24-21(23-16-11-6-3-7-12-16)25-20(17)22-15-9-4-2-5-10-15;/h2,4-5,8-10,13-14,16H,3,6-7,11-12H2,1H3,(H2,22,23,24,25);1H |
| InChIKey | GHAFPEFRWDWBHS-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |