C18H19FN6 — CID 16910617
2-N-cyclohexyl-4-N-(4-fluorophenyl)pteridine-2,4-diamine (PubChem CID 16910617) has the molecular formula C18H19FN6 and a molecular weight of 338.39 g/mol. Its IUPAC name is 2-N-cyclohexyl-4-N-(4-fluorophenyl)pteridine-2,4-diamine.
| Compound Name | 2-N-cyclohexyl-4-N-(4-fluorophenyl)pteridine-2,4-diamine |
|---|---|
| PubChem CID | 16910617 |
| Molecular Formula | C18H19FN6 |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 2-N-cyclohexyl-4-N-(4-fluorophenyl)pteridine-2,4-diamine |
| SMILES | Fc1ccc(Nc2nc(NC3CCCCC3)nc3nccnc23)cc1 |
| InChI | InChI=1S/C18H19FN6/c19-12-6-8-14(9-7-12)22-17-15-16(21-11-10-20-15)24-18(25-17)23-13-4-2-1-3-5-13/h6-11,13H,1-5H2,(H2,21,22,23,24,25) |
| InChIKey | QRQASRULEIABPG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |