C18H21FN6O2 — CID 16910626
2-N-(2,2-diethoxyethyl)-4-N-(4-fluorophenyl)pteridine-2,4-diamine (PubChem CID 16910626) has the molecular formula C18H21FN6O2 and a molecular weight of 372.40 g/mol. Its IUPAC name is 2-N-(2,2-diethoxyethyl)-4-N-(4-fluorophenyl)pteridine-2,4-diamine.
| Compound Name | 2-N-(2,2-diethoxyethyl)-4-N-(4-fluorophenyl)pteridine-2,4-diamine |
|---|---|
| PubChem CID | 16910626 |
| Molecular Formula | C18H21FN6O2 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 2-N-(2,2-diethoxyethyl)-4-N-(4-fluorophenyl)pteridine-2,4-diamine |
| SMILES | CCOC(CNc1nc(Nc2ccc(F)cc2)c2nccnc2n1)OCC |
| InChI | InChI=1S/C18H21FN6O2/c1-3-26-14(27-4-2)11-22-18-24-16-15(20-9-10-21-16)17(25-18)23-13-7-5-12(19)6-8-13/h5-10,14H,3-4,11H2,1-2H3,(H2,21,22,23,24,25) |
| InChIKey | VIYVZWZMTLZYQN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|