C19H16N6 — CID 16911184
2-N-benzyl-4-N-phenylpteridine-2,4-diamine (PubChem CID 16911184) has the molecular formula C19H16N6 and a molecular weight of 328.38 g/mol. Its IUPAC name is 2-N-benzyl-4-N-phenylpteridine-2,4-diamine.
| Compound Name | 2-N-benzyl-4-N-phenylpteridine-2,4-diamine |
|---|---|
| PubChem CID | 16911184 |
| Molecular Formula | C19H16N6 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 2-N-benzyl-4-N-phenylpteridine-2,4-diamine |
| SMILES | c1ccc(CNc2nc(Nc3ccccc3)c3nccnc3n2)cc1 |
| InChI | InChI=1S/C19H16N6/c1-3-7-14(8-4-1)13-22-19-24-17-16(20-11-12-21-17)18(25-19)23-15-9-5-2-6-10-15/h1-12H,13H2,(H2,21,22,23,24,25) |
| InChIKey | DPBVHJDGDGSWFV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |