C24H24N6 — CID 11372871
2-N,4-N,6-N-tribenzyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 11372871) has the molecular formula C24H24N6 and a molecular weight of 396.50 g/mol. Its IUPAC name is 2-N,4-N,6-N-tribenzyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N,6-N-tribenzyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 11372871 |
| Molecular Formula | C24H24N6 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 2-N,4-N,6-N-tribenzyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | c1ccc(CNc2nc(NCc3ccccc3)nc(NCc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C24H24N6/c1-4-10-19(11-5-1)16-25-22-28-23(26-17-20-12-6-2-7-13-20)30-24(29-22)27-18-21-14-8-3-9-15-21/h1-15H,16-18H2,(H3,25,26,27,28,29,30) |
| InChIKey | WNHWOHOTTGCSET-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |