About N-benzyl-4,6-bis(3-methylbutyl)pyrimidin-2-amine
N-benzyl-4,6-bis(3-methylbutyl)pyrimidin-2-amine (PubChem CID 25130562) has the molecular formula C21H31N3
and a molecular weight of 325.50 g/mol. Its IUPAC name is N-benzyl-4,6-bis(3-methylbutyl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | N-benzyl-4,6-bis(3-methylbutyl)pyrimidin-2-amine |
| PubChem CID | 25130562 |
| Molecular Formula | C21H31N3 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.25 |
| IUPAC Name | N-benzyl-4,6-bis(3-methylbutyl)pyrimidin-2-amine |
| SMILES | CC(C)CCc1cc(CCC(C)C)nc(NCc2ccccc2)n1 |
| InChI | InChI=1S/C21H31N3/c1-16(2)10-12-19-14-20(13-11-17(3)4)24-21(23-19)22-15-18-8-6-5-7-9-18/h5-9,14,16-17H,10-13,15H2,1-4H3,(H,22,23,24) |
| InChIKey | JDNITDJDXZLADF-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzyl-4,6-bis(3-methylbutyl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-4,6-bis(3-methylbutyl)pyrimidin-2-amine?
The IUPAC name of N-benzyl-4,6-bis(3-methylbutyl)pyrimidin-2-amine (CID 25130562) is N-benzyl-4,6-bis(3-methylbutyl)pyrimidin-2-amine.
What is the SMILES notation for N-benzyl-4,6-bis(3-methylbutyl)pyrimidin-2-amine?
The canonical SMILES for N-benzyl-4,6-bis(3-methylbutyl)pyrimidin-2-amine is CC(C)CCc1cc(CCC(C)C)nc(NCc2ccccc2)n1.
What is the InChIKey of N-benzyl-4,6-bis(3-methylbutyl)pyrimidin-2-amine?
The InChIKey is JDNITDJDXZLADF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H31N3/c1-16(2)10-12-19-14-20(13-11-17(3)4)24-21(23-19)22-15-18-8-6-5-7-9-18/h5-9,14,16-17H,10-13,15H2,1-4H3,(H,22,23,24).
What are the key properties of N-benzyl-4,6-bis(3-methylbutyl)pyrimidin-2-amine?
N-benzyl-4,6-bis(3-methylbutyl)pyrimidin-2-amine has a molecular weight of 325.50 g/mol, XLogP of 5.27, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-4,6-bis(3-methylbutyl)pyrimidin-2-amine is sourced from PubChem (CID 25130562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).