About ethene;3-methylbutylbenzene
ethene;3-methylbutylbenzene (PubChem CID 145421013) has the molecular formula C13H20
and a molecular weight of 176.30 g/mol. Its IUPAC name is ethene;3-methylbutylbenzene.
Molecular Properties
| Compound Name | ethene;3-methylbutylbenzene |
| PubChem CID | 145421013 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | ethene;3-methylbutylbenzene |
| SMILES | C=C.CC(C)CCc1ccccc1 |
| InChI | InChI=1S/C11H16.C2H4/c1-10(2)8-9-11-6-4-3-5-7-11;1-2/h3-7,10H,8-9H2,1-2H3;1-2H2 |
| InChIKey | ZORVXSRRSGKVCD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;3-methylbutylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;3-methylbutylbenzene?
The IUPAC name of ethene;3-methylbutylbenzene (CID 145421013) is ethene;3-methylbutylbenzene.
What is the SMILES notation for ethene;3-methylbutylbenzene?
The canonical SMILES for ethene;3-methylbutylbenzene is C=C.CC(C)CCc1ccccc1.
What is the InChIKey of ethene;3-methylbutylbenzene?
The InChIKey is ZORVXSRRSGKVCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16.C2H4/c1-10(2)8-9-11-6-4-3-5-7-11;1-2/h3-7,10H,8-9H2,1-2H3;1-2H2.
What are the key properties of ethene;3-methylbutylbenzene?
ethene;3-methylbutylbenzene has a molecular weight of 176.30 g/mol, XLogP of 4.08, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;3-methylbutylbenzene is sourced from PubChem (CID 145421013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).