C11H16O2 — CID 20647936
2-methyl-4-phenylbutane-1,1-diol (PubChem CID 20647936) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-methyl-4-phenylbutane-1,1-diol.
| Compound Name | 2-methyl-4-phenylbutane-1,1-diol |
|---|---|
| PubChem CID | 20647936 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 2-methyl-4-phenylbutane-1,1-diol |
| SMILES | CC(CCc1ccccc1)C(O)O |
| InChI | InChI=1S/C11H16O2/c1-9(11(12)13)7-8-10-5-3-2-4-6-10/h2-6,9,11-13H,7-8H2,1H3 |
| InChIKey | UBSGUVGUSOXTTQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|