C13H18O — CID 88857677
(2S,3R)-2,3-dimethyl-5-phenylpentanal (PubChem CID 88857677) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is (2S,3R)-2,3-dimethyl-5-phenylpentanal.
| Compound Name | (2S,3R)-2,3-dimethyl-5-phenylpentanal |
|---|---|
| PubChem CID | 88857677 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | (2S,3R)-2,3-dimethyl-5-phenylpentanal |
| SMILES | C[C@H](C=O)[C@H](C)CCc1ccccc1 |
| InChI | InChI=1S/C13H18O/c1-11(12(2)10-14)8-9-13-6-4-3-5-7-13/h3-7,10-12H,8-9H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | JCGDHMMNPFJXDX-VXGBXAGGSA-N |
| XLogP | 3.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|