C12H16O — CID 129363881
(Z,3R)-1-phenylhex-4-en-3-ol (PubChem CID 129363881) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is (Z,3R)-1-phenylhex-4-en-3-ol.
| Compound Name | (Z,3R)-1-phenylhex-4-en-3-ol |
|---|---|
| PubChem CID | 129363881 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | (Z,3R)-1-phenylhex-4-en-3-ol |
| SMILES | C/C=C\[C@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C12H16O/c1-2-6-12(13)10-9-11-7-4-3-5-8-11/h2-8,12-13H,9-10H2,1H3/b6-2-/t12-/m0/s1 |
| InChIKey | LPEOSCXPDHOVJA-DWMUBGRBSA-N |
| XLogP | 2.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|