C13H13F3O2 — CID 10015355
(E)-1,1,1-trifluoro-5-hydroxy-7-phenylhept-3-en-2-one (PubChem CID 10015355) has the molecular formula C13H13F3O2 and a molecular weight of 258.24 g/mol. Its IUPAC name is (E)-1,1,1-trifluoro-5-hydroxy-7-phenylhept-3-en-2-one.
| Compound Name | (E)-1,1,1-trifluoro-5-hydroxy-7-phenylhept-3-en-2-one |
|---|---|
| PubChem CID | 10015355 |
| Molecular Formula | C13H13F3O2 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | (E)-1,1,1-trifluoro-5-hydroxy-7-phenylhept-3-en-2-one |
| SMILES | O=C(/C=C/C(O)CCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H13F3O2/c14-13(15,16)12(18)9-8-11(17)7-6-10-4-2-1-3-5-10/h1-5,8-9,11,17H,6-7H2/b9-8+ |
| InChIKey | JTUXAQNSAYYMHO-CMDGGOBGSA-N |
| XLogP | 2.67 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|