C12H12F3NO — CID 3572960
1,1,1-trifluoro-4-(2-phenylethylamino)but-3-en-2-one (PubChem CID 3572960) has the molecular formula C12H12F3NO and a molecular weight of 243.23 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-(2-phenylethylamino)but-3-en-2-one.
| Compound Name | 1,1,1-trifluoro-4-(2-phenylethylamino)but-3-en-2-one |
|---|---|
| PubChem CID | 3572960 |
| Molecular Formula | C12H12F3NO |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 1,1,1-trifluoro-4-(2-phenylethylamino)but-3-en-2-one |
| SMILES | O=C(C=CNCCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H12F3NO/c13-12(14,15)11(17)7-9-16-8-6-10-4-2-1-3-5-10/h1-5,7,9,16H,6,8H2 |
| InChIKey | BJWWSCMTCOWXGU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|