C12H15NO2 — CID 103256398
(E)-3-[2-(2-methylphenyl)ethylamino]prop-2-enoic acid (PubChem CID 103256398) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is (E)-3-[2-(2-methylphenyl)ethylamino]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(2-methylphenyl)ethylamino]prop-2-enoic acid |
|---|---|
| PubChem CID | 103256398 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (E)-3-[2-(2-methylphenyl)ethylamino]prop-2-enoic acid |
| SMILES | Cc1ccccc1CCN/C=C/C(=O)O |
| InChI | InChI=1S/C12H15NO2/c1-10-4-2-3-5-11(10)6-8-13-9-7-12(14)15/h2-5,7,9,13H,6,8H2,1H3,(H,14,15)/b9-7+ |
| InChIKey | MBRHZFXQWKWKIT-VQHVLOKHSA-N |
| XLogP | 1.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|