About N-methyl-2-(2-methylphenyl)ethanamine;toluene
N-methyl-2-(2-methylphenyl)ethanamine;toluene (PubChem CID 142152670) has the molecular formula C17H23N
and a molecular weight of 241.38 g/mol. Its IUPAC name is N-methyl-2-(2-methylphenyl)ethanamine;toluene.
Molecular Properties
| Compound Name | N-methyl-2-(2-methylphenyl)ethanamine;toluene |
| PubChem CID | 142152670 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | N-methyl-2-(2-methylphenyl)ethanamine;toluene |
| SMILES | CNCCc1ccccc1C.Cc1ccccc1 |
| InChI | InChI=1S/C10H15N.C7H8/c1-9-5-3-4-6-10(9)7-8-11-2;1-7-5-3-2-4-6-7/h3-6,11H,7-8H2,1-2H3;2-6H,1H3 |
| InChIKey | GBRLQRPJHWUXTP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-methyl-2-(2-methylphenyl)ethanamine;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-(2-methylphenyl)ethanamine;toluene?
The IUPAC name of N-methyl-2-(2-methylphenyl)ethanamine;toluene (CID 142152670) is N-methyl-2-(2-methylphenyl)ethanamine;toluene.
What is the SMILES notation for N-methyl-2-(2-methylphenyl)ethanamine;toluene?
The canonical SMILES for N-methyl-2-(2-methylphenyl)ethanamine;toluene is CNCCc1ccccc1C.Cc1ccccc1.
What is the InChIKey of N-methyl-2-(2-methylphenyl)ethanamine;toluene?
The InChIKey is GBRLQRPJHWUXTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N.C7H8/c1-9-5-3-4-6-10(9)7-8-11-2;1-7-5-3-2-4-6-7/h3-6,11H,7-8H2,1-2H3;2-6H,1H3.
What are the key properties of N-methyl-2-(2-methylphenyl)ethanamine;toluene?
N-methyl-2-(2-methylphenyl)ethanamine;toluene has a molecular weight of 241.38 g/mol, XLogP of 3.75, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-(2-methylphenyl)ethanamine;toluene is sourced from PubChem (CID 142152670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).