C14H24N2 — CID 115202150
N-methyl-N'-[2-(2-methylphenyl)ethyl]butane-1,4-diamine (PubChem CID 115202150) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is N-methyl-N'-[2-(2-methylphenyl)ethyl]butane-1,4-diamine.
| Compound Name | N-methyl-N'-[2-(2-methylphenyl)ethyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 115202150 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | N-methyl-N'-[2-(2-methylphenyl)ethyl]butane-1,4-diamine |
| SMILES | CNCCCCNCCc1ccccc1C |
| InChI | InChI=1S/C14H24N2/c1-13-7-3-4-8-14(13)9-12-16-11-6-5-10-15-2/h3-4,7-8,15-16H,5-6,9-12H2,1-2H3 |
| InChIKey | RJXHYUKNNDODEV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|