C14H23BrN2 — CID 115202149
N'-[2-(5-bromo-2-methylphenyl)ethyl]-N-methylbutane-1,4-diamine (PubChem CID 115202149) has the molecular formula C14H23BrN2 and a molecular weight of 299.26 g/mol. Its IUPAC name is N'-[2-(5-bromo-2-methylphenyl)ethyl]-N-methylbutane-1,4-diamine.
| Compound Name | N'-[2-(5-bromo-2-methylphenyl)ethyl]-N-methylbutane-1,4-diamine |
|---|---|
| PubChem CID | 115202149 |
| Molecular Formula | C14H23BrN2 |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | N'-[2-(5-bromo-2-methylphenyl)ethyl]-N-methylbutane-1,4-diamine |
| SMILES | CNCCCCNCCc1cc(Br)ccc1C |
| InChI | InChI=1S/C14H23BrN2/c1-12-5-6-14(15)11-13(12)7-10-17-9-4-3-8-16-2/h5-6,11,16-17H,3-4,7-10H2,1-2H3 |
| InChIKey | DRTYJRYMQRWYOI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|