C12H19BrN2O — CID 115121662
1-amino-3-[2-(5-bromo-2-methylphenyl)ethylamino]propan-2-ol (PubChem CID 115121662) has the molecular formula C12H19BrN2O and a molecular weight of 287.20 g/mol. Its IUPAC name is 1-amino-3-[2-(5-bromo-2-methylphenyl)ethylamino]propan-2-ol.
| Compound Name | 1-amino-3-[2-(5-bromo-2-methylphenyl)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 115121662 |
| Molecular Formula | C12H19BrN2O |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 1-amino-3-[2-(5-bromo-2-methylphenyl)ethylamino]propan-2-ol |
| SMILES | Cc1ccc(Br)cc1CCNCC(O)CN |
| InChI | InChI=1S/C12H19BrN2O/c1-9-2-3-11(13)6-10(9)4-5-15-8-12(16)7-14/h2-3,6,12,15-16H,4-5,7-8,14H2,1H3 |
| InChIKey | YOBFXYJTRJYFFW-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|